CAS 21378-88-1 is the registry number for Alprenolol tartrate. Offered by: TargetMol. Available pack sizes: 25mg, 50mg, 100mg.
(2R,3R)-2,3-dihydroxybutanedioic acid;1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-ol (CAS 21378-88-1) is a chemical compound with the molecular formula C19H29NO8 and a molecular weight of 399.4 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-ol. InChIKey: MADUQKMQKQDWJH-LREBCSMRSA-N.
| Molecular formula | C19H29NO8 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-ol |
| InChIKey | MADUQKMQKQDWJH-LREBCSMRSA-N |
| SMILES | CC(C)NCC(COC1=CC=CC=C1CC=C)O.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)