Products 2137823-37-9

CAS 2137823-37-9 is the registry number for 1-Ethynylcyclopropane-1-sulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-ethynylcyclopropane-1-sulfonyl fluoride (CAS 2137823-37-9) is a chemical compound with the molecular formula C5H5FO2S and a molecular weight of 148.16 g/mol. IUPAC name: 1-ethynylcyclopropane-1-sulfonyl fluoride. InChIKey: SMGJCHYHPQOUQN-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5FO2S
Molecular weight148.16 g/mol
IUPAC name1-ethynylcyclopropane-1-sulfonyl fluoride
InChIKeySMGJCHYHPQOUQN-UHFFFAOYSA-N
SMILESC#CC1(CC1)S(=O)(=O)F

Computed by PubChem (NCBI)