CAS 2137830-26-1 is the registry number for 6-(tert-Butoxycarbonyl)-8-fluoro-6-azaspiro(3.4)octane-8-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
8-fluoro-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[3.4]octane-8-carboxylic acid (CAS 2137830-26-1) is a chemical compound with the molecular formula C13H20FNO4 and a molecular weight of 273.30 g/mol. IUPAC name: 8-fluoro-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[3.4]octane-8-carboxylic acid. InChIKey: QRQQDYAUTNGEIH-UHFFFAOYSA-N.
| Molecular formula | C13H20FNO4 |
|---|---|
| Molecular weight | 273.30 g/mol |
| IUPAC name | 8-fluoro-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[3.4]octane-8-carboxylic acid |
| InChIKey | QRQQDYAUTNGEIH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCC2)C(C1)(C(=O)O)F |
Computed by PubChem (NCBI)