Products 2137851-57-9
CAS 2137851-57-9 is the registry number for 1-(3-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)propyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]triazole-4-carboxylic acid (CAS 2137851-57-9) is a chemical compound with the molecular formula C21H20N4O4 and a molecular weight of 392.4 g/mol. IUPAC name: 1-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]triazole-4-carboxylic acid. InChIKey: WUXQVOXKRJELGV-UHFFFAOYSA-N.
| Molecular formula | C21H20N4O4 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 1-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]triazole-4-carboxylic acid |
| InChIKey | WUXQVOXKRJELGV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCN4C=C(N=N4)C(=O)O |
Computed by PubChem (NCBI)