Products 2137930-52-8

CAS 2137930-52-8 is the registry number for Pyrrolidine-3-sulfonyl fluoride hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

Pyrrolidine-3-sulfonyl fluoride;hydrochloride (CAS 2137930-52-8) is a chemical compound with the molecular formula C4H9ClFNO2S and a molecular weight of 189.64 g/mol. IUPAC name: pyrrolidine-3-sulfonyl fluoride;hydrochloride. InChIKey: VODCLWNXBWHCRR-UHFFFAOYSA-N.

Identity
Molecular formulaC4H9ClFNO2S
Molecular weight189.64 g/mol
IUPAC namepyrrolidine-3-sulfonyl fluoride;hydrochloride
InChIKeyVODCLWNXBWHCRR-UHFFFAOYSA-N
SMILESC1CNCC1S(=O)(=O)F.Cl

Computed by PubChem (NCBI)