Products 2137936-72-0

CAS 2137936-72-0 is the registry number for Ethyl 4-oxo-2-(trifluoromethyl)cyclohexane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 4-oxo-2-(trifluoromethyl)cyclohexane-1-carboxylate (CAS 2137936-72-0) is a chemical compound with the molecular formula C10H13F3O3 and a molecular weight of 238.20 g/mol. IUPAC name: ethyl 4-oxo-2-(trifluoromethyl)cyclohexane-1-carboxylate. InChIKey: ASWATKRNDNOHEP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13F3O3
Molecular weight238.20 g/mol
IUPAC nameethyl 4-oxo-2-(trifluoromethyl)cyclohexane-1-carboxylate
InChIKeyASWATKRNDNOHEP-UHFFFAOYSA-N
SMILESCCOC(=O)C1CCC(=O)CC1C(F)(F)F

Computed by PubChem (NCBI)