CAS 2138032-69-4 is the registry number for Sodium 5-bromo-3-carboxypyridine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.
Sodium 5-bromo-3-carboxypyridine-2-carboxylate (CAS 2138032-69-4) is a chemical compound with the molecular formula C7H3BrNNaO4 and a molecular weight of 268.00 g/mol. IUPAC name: sodium 5-bromo-3-carboxypyridine-2-carboxylate. InChIKey: NIZNEBWEIKMHJV-UHFFFAOYSA-M.
| Molecular formula | C7H3BrNNaO4 |
|---|---|
| Molecular weight | 268.00 g/mol |
| IUPAC name | sodium 5-bromo-3-carboxypyridine-2-carboxylate |
| InChIKey | NIZNEBWEIKMHJV-UHFFFAOYSA-M |
| SMILES | C1=C(C=NC(=C1C(=O)O)C(=O)[O-])Br.[Na+] |
Computed by PubChem (NCBI)