Products 2138033-97-1

CAS 2138033-97-1 is the registry number for 4-​(1,​1-​Dioxido-​2-​isothiazolidinyl)​hexahydro-​1H-​azepine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(azepan-4-yl)-1,2-thiazolidine 1,1-dioxide;hydrochloride (CAS 2138033-97-1) is a chemical compound with the molecular formula C9H19ClN2O2S and a molecular weight of 254.78 g/mol. IUPAC name: 2-(azepan-4-yl)-1,2-thiazolidine 1,1-dioxide;hydrochloride. InChIKey: IKRZDSQCZSVLKV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H19ClN2O2S
Molecular weight254.78 g/mol
IUPAC name2-(azepan-4-yl)-1,2-thiazolidine 1,1-dioxide;hydrochloride
InChIKeyIKRZDSQCZSVLKV-UHFFFAOYSA-N
SMILESC1CC(CCNC1)N2CCCS2(=O)=O.Cl

Computed by PubChem (NCBI)