CAS 2138045-16-4 appears in our catalog under these names: 5-(pentafluoroethyl)-1h-1,3-benzodiazol-2-amine, 95%, 5-(Perfluoroethyl)-1H-benzo(d)imidazol-2-amine, 98%, 5-(Pentafluoroethyl)-1H-1,3-benzodiazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 50mg.
6-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazol-2-amine (CAS 2138045-16-4) is a chemical compound with the molecular formula C9H6F5N3 and a molecular weight of 251.16 g/mol. IUPAC name: 6-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazol-2-amine. InChIKey: ADDZAUMCNGTEPR-UHFFFAOYSA-N.
| Molecular formula | C9H6F5N3 |
|---|---|
| Molecular weight | 251.16 g/mol |
| IUPAC name | 6-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazol-2-amine |
| InChIKey | ADDZAUMCNGTEPR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(C(F)(F)F)(F)F)NC(=N2)N |
Computed by PubChem (NCBI)