CAS 2138076-26-1 is the registry number for Hexahydro-2H-isothiazolo(2,3-a)pyrazine 1,1-dioxide 2,2,2-trifluoroacetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,3a,4,5,6,7-hexahydro-2H-[1,2]thiazolo[2,3-a]pyrazine 1,1-dioxide;2,2,2-trifluoroacetic acid (CAS 2138076-26-1) is a chemical compound with the molecular formula C8H13F3N2O4S and a molecular weight of 290.26 g/mol. IUPAC name: 3,3a,4,5,6,7-hexahydro-2H-[1,2]thiazolo[2,3-a]pyrazine 1,1-dioxide;2,2,2-trifluoroacetic acid. InChIKey: UKGSAGLMIPVDFG-UHFFFAOYSA-N.
| Molecular formula | C8H13F3N2O4S |
|---|---|
| Molecular weight | 290.26 g/mol |
| IUPAC name | 3,3a,4,5,6,7-hexahydro-2H-[1,2]thiazolo[2,3-a]pyrazine 1,1-dioxide;2,2,2-trifluoroacetic acid |
| InChIKey | UKGSAGLMIPVDFG-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)N2C1CNCC2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)