CAS 2138086-22-1 is the registry number for potassium 2-(pyridin-2-yloxy)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Potassium 2-pyridin-2-yloxyacetate (CAS 2138086-22-1) is a chemical compound with the molecular formula C7H6KNO3 and a molecular weight of 191.23 g/mol. IUPAC name: potassium 2-pyridin-2-yloxyacetate. InChIKey: HVAOHPSSTQKGAU-UHFFFAOYSA-M.
| Molecular formula | C7H6KNO3 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | potassium 2-pyridin-2-yloxyacetate |
| InChIKey | HVAOHPSSTQKGAU-UHFFFAOYSA-M |
| SMILES | C1=CC=NC(=C1)OCC(=O)[O-].[K+] |
Computed by PubChem (NCBI)