Products 2138098-59-4

CAS 2138098-59-4 is the registry number for 2-(Piperazin-1-yl)-1,3-thiazole-4-carboxylic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-piperazin-1-yl-1,3-thiazole-4-carboxylic acid;dihydrochloride (CAS 2138098-59-4) is a chemical compound with the molecular formula C8H13Cl2N3O2S and a molecular weight of 286.18 g/mol. IUPAC name: 2-piperazin-1-yl-1,3-thiazole-4-carboxylic acid;dihydrochloride. InChIKey: ULTJGUMAYLIVPS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13Cl2N3O2S
Molecular weight286.18 g/mol
IUPAC name2-piperazin-1-yl-1,3-thiazole-4-carboxylic acid;dihydrochloride
InChIKeyULTJGUMAYLIVPS-UHFFFAOYSA-N
SMILESC1CN(CCN1)C2=NC(=CS2)C(=O)O.Cl.Cl

Computed by PubChem (NCBI)