Products 2138098-91-4
CAS 2138098-91-4 is the registry number for 6-Bromo-3-((tert-butoxycarbonyl)amino)pyrazine-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazine-2-carboxylic acid (CAS 2138098-91-4) is a chemical compound with the molecular formula C10H12BrN3O4 and a molecular weight of 318.12 g/mol. IUPAC name: 6-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazine-2-carboxylic acid. InChIKey: FNFTZNOCILCPLB-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN3O4 |
|---|---|
| Molecular weight | 318.12 g/mol |
| IUPAC name | 6-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazine-2-carboxylic acid |
| InChIKey | FNFTZNOCILCPLB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(N=C1C(=O)O)Br |
Computed by PubChem (NCBI)