Products 2138103-41-8
CAS 2138103-41-8 is the registry number for 2-{1-((tert-Butoxy)carbonyl)-3-(1-fluoroethenyl)azetidin-3-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[3-(1-fluoroethenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid (CAS 2138103-41-8) is a chemical compound with the molecular formula C12H18FNO4 and a molecular weight of 259.27 g/mol. IUPAC name: 2-[3-(1-fluoroethenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid. InChIKey: VXASAPKBJTXORC-UHFFFAOYSA-N.
| Molecular formula | C12H18FNO4 |
|---|---|
| Molecular weight | 259.27 g/mol |
| IUPAC name | 2-[3-(1-fluoroethenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid |
| InChIKey | VXASAPKBJTXORC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(CC(=O)O)C(=C)F |
Computed by PubChem (NCBI)