Products 2138151-98-9

CAS 2138151-98-9 is the registry number for Ethyl 4-oxo-5-(trifluoromethyl)cycloheptane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 4-oxo-5-(trifluoromethyl)cycloheptane-1-carboxylate (CAS 2138151-98-9) is a chemical compound with the molecular formula C11H15F3O3 and a molecular weight of 252.23 g/mol. IUPAC name: ethyl 4-oxo-5-(trifluoromethyl)cycloheptane-1-carboxylate. InChIKey: GCKIRGYKIRZEEG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15F3O3
Molecular weight252.23 g/mol
IUPAC nameethyl 4-oxo-5-(trifluoromethyl)cycloheptane-1-carboxylate
InChIKeyGCKIRGYKIRZEEG-UHFFFAOYSA-N
SMILESCCOC(=O)C1CCC(C(=O)CC1)C(F)(F)F

Computed by PubChem (NCBI)