Products 2138174-09-9

CAS 2138174-09-9 appears in our catalog under these names: 5-Formylthiophene-3-sulfonyl chloride, 95.0%, 5-Formylthiophene-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

5-formylthiophene-3-sulfonyl chloride (CAS 2138174-09-9) is a chemical compound with the molecular formula C5H3ClO3S2 and a molecular weight of 210.7 g/mol. IUPAC name: 5-formylthiophene-3-sulfonyl chloride. InChIKey: GAYQJNBOKKXKQE-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3ClO3S2
Molecular weight210.7 g/mol
IUPAC name5-formylthiophene-3-sulfonyl chloride
InChIKeyGAYQJNBOKKXKQE-UHFFFAOYSA-N
SMILESC1=C(SC=C1S(=O)(=O)Cl)C=O

Computed by PubChem (NCBI)