CAS 2138180-49-9 appears in our catalog under these names: Sodium 2,5-dichloropyridine-3-carboxylate, 95%, Sodium 2,5-dichloronicotinate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
Sodium 2,5-dichloropyridine-3-carboxylate (CAS 2138180-49-9) is a chemical compound with the molecular formula C6H2Cl2NNaO2 and a molecular weight of 213.98 g/mol. IUPAC name: sodium 2,5-dichloropyridine-3-carboxylate. InChIKey: TUYLRJJTFPILFG-UHFFFAOYSA-M.
| Molecular formula | C6H2Cl2NNaO2 |
|---|---|
| Molecular weight | 213.98 g/mol |
| IUPAC name | sodium 2,5-dichloropyridine-3-carboxylate |
| InChIKey | TUYLRJJTFPILFG-UHFFFAOYSA-M |
| SMILES | C1=C(C=NC(=C1C(=O)[O-])Cl)Cl.[Na+] |
Computed by PubChem (NCBI)