CAS 2138181-01-6 is the registry number for rel-(4aR,7aR)-4a-(Trifluoromethyl)octahydrothiopyrano(2,3-c)pyrrole 1,1-dioxide, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
(4aS,7aS)-4a-(trifluoromethyl)-3,4,5,6,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole 1,1-dioxide (CAS 2138181-01-6) is a chemical compound with the molecular formula C8H12F3NO2S and a molecular weight of 243.25 g/mol. IUPAC name: (4aS,7aS)-4a-(trifluoromethyl)-3,4,5,6,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole 1,1-dioxide. InChIKey: OPHIIKVCMHAKIY-RNFRBKRXSA-N.
| Molecular formula | C8H12F3NO2S |
|---|---|
| Molecular weight | 243.25 g/mol |
| IUPAC name | (4aS,7aS)-4a-(trifluoromethyl)-3,4,5,6,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole 1,1-dioxide |
| InChIKey | OPHIIKVCMHAKIY-RNFRBKRXSA-N |
| SMILES | C1C[C@]2(CNC[C@H]2S(=O)(=O)C1)C(F)(F)F |
Computed by PubChem (NCBI)