Products 1544381-45-4

CAS 1544381-45-4 is the registry number for 4-(3,3,3-Trifluoropropyl)thiomorpholine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(3,3,3-trifluoropropyl)thiomorpholine-3-carboxylic acid (CAS 1544381-45-4) is a chemical compound with the molecular formula C8H12F3NO2S and a molecular weight of 243.25 g/mol. IUPAC name: 4-(3,3,3-trifluoropropyl)thiomorpholine-3-carboxylic acid. InChIKey: VKXIXZKKYXHLHO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12F3NO2S
Molecular weight243.25 g/mol
IUPAC name4-(3,3,3-trifluoropropyl)thiomorpholine-3-carboxylic acid
InChIKeyVKXIXZKKYXHLHO-UHFFFAOYSA-N
SMILESC1CSCC(N1CCC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)