CAS 2138212-72-1 is the registry number for N-(Oxetan-3-yl)azetidin-3-amine, bis(trifluoroacetic acid). Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-(oxetan-3-yl)azetidin-3-amine;bis(2,2,2-trifluoroacetic acid) (CAS 2138212-72-1) is a chemical compound with the molecular formula C10H14F6N2O5 and a molecular weight of 356.22 g/mol. IUPAC name: N-(oxetan-3-yl)azetidin-3-amine;bis(2,2,2-trifluoroacetic acid). InChIKey: LXNNBRDMCRIOQY-UHFFFAOYSA-N.
| Molecular formula | C10H14F6N2O5 |
|---|---|
| Molecular weight | 356.22 g/mol |
| IUPAC name | N-(oxetan-3-yl)azetidin-3-amine;bis(2,2,2-trifluoroacetic acid) |
| InChIKey | LXNNBRDMCRIOQY-UHFFFAOYSA-N |
| SMILES | C1C(CN1)NC2COC2.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)