Products 2138213-22-4
CAS 2138213-22-4 is the registry number for 2-(5-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2,3-dihydro-1H-indol-3-yl)acetic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
2-[5-bromo-1-(9H-fluoren-9-ylmethoxycarbonyl)-2,3-dihydroindol-3-yl]acetic acid (CAS 2138213-22-4) is a chemical compound with the molecular formula C25H20BrNO4 and a molecular weight of 478.3 g/mol. IUPAC name: 2-[5-bromo-1-(9H-fluoren-9-ylmethoxycarbonyl)-2,3-dihydroindol-3-yl]acetic acid. InChIKey: JHRJSCDHSRFHKR-UHFFFAOYSA-N.
| Molecular formula | C25H20BrNO4 |
|---|---|
| Molecular weight | 478.3 g/mol |
| IUPAC name | 2-[5-bromo-1-(9H-fluoren-9-ylmethoxycarbonyl)-2,3-dihydroindol-3-yl]acetic acid |
| InChIKey | JHRJSCDHSRFHKR-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(N1C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C=CC(=C2)Br)CC(=O)O |
Computed by PubChem (NCBI)