Products 2138213-86-0

CAS 2138213-86-0 is the registry number for 2-Methyl-6-oxo-1,6-dihydropyrimidine-4-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-methyl-6-oxo-1H-pyrimidine-4-carboxylic acid;hydrochloride (CAS 2138213-86-0) is a chemical compound with the molecular formula C6H7ClN2O3 and a molecular weight of 190.58 g/mol. IUPAC name: 2-methyl-6-oxo-1H-pyrimidine-4-carboxylic acid;hydrochloride. InChIKey: RAWWQSMKDHOSMW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7ClN2O3
Molecular weight190.58 g/mol
IUPAC name2-methyl-6-oxo-1H-pyrimidine-4-carboxylic acid;hydrochloride
InChIKeyRAWWQSMKDHOSMW-UHFFFAOYSA-N
SMILESCC1=NC(=CC(=O)N1)C(=O)O.Cl

Computed by PubChem (NCBI)