CAS 2138217-05-5 is the registry number for 6-Imino-6,9-dihydro-3H-purine-2-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-amino-7H-purine-2-carboxamide (CAS 2138217-05-5) is a chemical compound with the molecular formula C6H6N6O and a molecular weight of 178.15 g/mol. IUPAC name: 6-amino-7H-purine-2-carboxamide. InChIKey: VCHVLAGUEDBYDI-UHFFFAOYSA-N.
| Molecular formula | C6H6N6O |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 6-amino-7H-purine-2-carboxamide |
| InChIKey | VCHVLAGUEDBYDI-UHFFFAOYSA-N |
| SMILES | C1=NC2=NC(=NC(=C2N1)N)C(=O)N |
Computed by PubChem (NCBI)