CAS 2138232-95-6 appears in our catalog under these names: Methyl 2-bromo-5-(chlorosulfonyl)furan-3-carboxylate, 98%, Methyl 2-bromo-5-(chlorosulfonyl)furan-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 2-bromo-5-chlorosulfonylfuran-3-carboxylate (CAS 2138232-95-6) is a chemical compound with the molecular formula C6H4BrClO5S and a molecular weight of 303.52 g/mol. IUPAC name: methyl 2-bromo-5-chlorosulfonylfuran-3-carboxylate. InChIKey: DUTVKUGFMPLMAO-UHFFFAOYSA-N.
| Molecular formula | C6H4BrClO5S |
|---|---|
| Molecular weight | 303.52 g/mol |
| IUPAC name | methyl 2-bromo-5-chlorosulfonylfuran-3-carboxylate |
| InChIKey | DUTVKUGFMPLMAO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(OC(=C1)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)