CAS 2138256-21-8 is the registry number for 1-Benzyl-4-phenylpiperidine-4-carbonyl chloride hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-benzyl-4-phenylpiperidine-4-carbonyl chloride;hydrochloride (CAS 2138256-21-8) is a chemical compound with the molecular formula C19H21Cl2NO and a molecular weight of 350.3 g/mol. IUPAC name: 1-benzyl-4-phenylpiperidine-4-carbonyl chloride;hydrochloride. InChIKey: WZFJVVIUAWMIKA-UHFFFAOYSA-N.
| Molecular formula | C19H21Cl2NO |
|---|---|
| Molecular weight | 350.3 g/mol |
| IUPAC name | 1-benzyl-4-phenylpiperidine-4-carbonyl chloride;hydrochloride |
| InChIKey | WZFJVVIUAWMIKA-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(C2=CC=CC=C2)C(=O)Cl)CC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)