CAS 2138271-79-9 is the registry number for rac-(1R,2R)-2-((1H-1,2,3-Triazol-1-yl)methyl)cyclopentan-1-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Trans-(1R,2R)-2-(triazol-1-ylmethyl)cyclopentan-1-amine;dihydrochloride (CAS 2138271-79-9) is a chemical compound with the molecular formula C8H16Cl2N4 and a molecular weight of 239.14 g/mol. IUPAC name: trans-(1R,2R)-2-(triazol-1-ylmethyl)cyclopentan-1-amine;dihydrochloride. InChIKey: YDBVJODGRJUSSE-RHJRFJOKSA-N.
| Molecular formula | C8H16Cl2N4 |
|---|---|
| Molecular weight | 239.14 g/mol |
| IUPAC name | trans-(1R,2R)-2-(triazol-1-ylmethyl)cyclopentan-1-amine;dihydrochloride |
| InChIKey | YDBVJODGRJUSSE-RHJRFJOKSA-N |
| SMILES | C1C[C@@H]([C@@H](C1)N)CN2C=CN=N2.Cl.Cl |
Computed by PubChem (NCBI)