CAS 2138279-69-1 is the registry number for 4-benzyl-1,3-thiazole-2-carboxylate lithium. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Lithium 4-benzyl-1,3-thiazole-2-carboxylate (CAS 2138279-69-1) is a chemical compound with the molecular formula C11H8LiNO2S and a molecular weight of 225.2 g/mol. IUPAC name: lithium 4-benzyl-1,3-thiazole-2-carboxylate. InChIKey: CSZYDYBCKHXXTO-UHFFFAOYSA-M.
| Molecular formula | C11H8LiNO2S |
|---|---|
| Molecular weight | 225.2 g/mol |
| IUPAC name | lithium 4-benzyl-1,3-thiazole-2-carboxylate |
| InChIKey | CSZYDYBCKHXXTO-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC=C(C=C1)CC2=CSC(=N2)C(=O)[O-] |
Computed by PubChem (NCBI)