Products 2138282-07-0
CAS 2138282-07-0 is the registry number for rac-(1R,5R)-1-(Pyridin-3-yl)-2-azabicyclo(3.2.0)heptane. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1S,5S)-1-pyridin-3-yl-2-azabicyclo[3.2.0]heptane (CAS 2138282-07-0) is a chemical compound with the molecular formula C11H14N2 and a molecular weight of 174.24 g/mol. IUPAC name: (1S,5S)-1-pyridin-3-yl-2-azabicyclo[3.2.0]heptane. InChIKey: QNWIXLVIVYWSCN-ONGXEEELSA-N.
| Molecular formula | C11H14N2 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | (1S,5S)-1-pyridin-3-yl-2-azabicyclo[3.2.0]heptane |
| InChIKey | QNWIXLVIVYWSCN-ONGXEEELSA-N |
| SMILES | C1C[C@]2([C@@H]1CCN2)C3=CN=CC=C3 |
Computed by PubChem (NCBI)