CAS 2138284-53-2 is the registry number for 1,3-Dimethyl-1H,4H,5H,6H,7H-pyrazolo(3,4-b)pyridin-5-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-b]pyridin-5-amine;dihydrochloride (CAS 2138284-53-2) is a chemical compound with the molecular formula C8H16Cl2N4 and a molecular weight of 239.14 g/mol. IUPAC name: 1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-b]pyridin-5-amine;dihydrochloride. InChIKey: GTYFZVRASUOEIL-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2N4 |
|---|---|
| Molecular weight | 239.14 g/mol |
| IUPAC name | 1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-b]pyridin-5-amine;dihydrochloride |
| InChIKey | GTYFZVRASUOEIL-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1CC(CN2)N)C.Cl.Cl |
Computed by PubChem (NCBI)