CAS 2138288-40-9 is the registry number for Sodium 3-(1-methylpiperidin-4-yl)-1H-1,2,4-triazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Sodium 5-(1-methylpiperidin-4-yl)-1H-1,2,4-triazole-3-carboxylate (CAS 2138288-40-9) is a chemical compound with the molecular formula C9H13N4NaO2 and a molecular weight of 232.22 g/mol. IUPAC name: sodium 5-(1-methylpiperidin-4-yl)-1H-1,2,4-triazole-3-carboxylate. InChIKey: NKPPWKCNBBNQCB-UHFFFAOYSA-M.
| Molecular formula | C9H13N4NaO2 |
|---|---|
| Molecular weight | 232.22 g/mol |
| IUPAC name | sodium 5-(1-methylpiperidin-4-yl)-1H-1,2,4-triazole-3-carboxylate |
| InChIKey | NKPPWKCNBBNQCB-UHFFFAOYSA-M |
| SMILES | CN1CCC(CC1)C2=NC(=NN2)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)