CAS 2138311-80-3 appears in our catalog under these names: 3-tert-Butyl-1,2,4-oxadiazole-5-carboxylate lithium, lithium(1+) ion 3-tert-butyl-1,2,4-oxadiazole-5-carboxylate, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 1g, 100mg, 250mg, 10g.
Lithium 3-tert-butyl-1,2,4-oxadiazole-5-carboxylate (CAS 2138311-80-3) is a chemical compound with the molecular formula C7H9LiN2O3 and a molecular weight of 176.1 g/mol. IUPAC name: lithium 3-tert-butyl-1,2,4-oxadiazole-5-carboxylate. InChIKey: NHVHKRUVGMETSM-UHFFFAOYSA-M.
| Molecular formula | C7H9LiN2O3 |
|---|---|
| Molecular weight | 176.1 g/mol |
| IUPAC name | lithium 3-tert-butyl-1,2,4-oxadiazole-5-carboxylate |
| InChIKey | NHVHKRUVGMETSM-UHFFFAOYSA-M |
| SMILES | [Li+].CC(C)(C)C1=NOC(=N1)C(=O)[O-] |
Computed by PubChem (NCBI)