Products 2138330-43-3
CAS 2138330-43-3 is the registry number for Photosensitizer-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-[5-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid (CAS 2138330-43-3) is a chemical compound with the molecular formula C29H21NO2S2 and a molecular weight of 479.6 g/mol. IUPAC name: (E)-3-[5-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid. InChIKey: ICLZNGAELWYHKL-CAPFRKAQSA-N.
| Molecular formula | C29H21NO2S2 |
|---|---|
| Molecular weight | 479.6 g/mol |
| IUPAC name | (E)-3-[5-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
| InChIKey | ICLZNGAELWYHKL-CAPFRKAQSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(S4)C5=CC=C(S5)/C=C/C(=O)O |
Computed by PubChem (NCBI)