Products 2138351-52-5

CAS 2138351-52-5 is the registry number for Trimethylthiophene-3-sulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,4,5-trimethylthiophene-3-sulfonyl fluoride (CAS 2138351-52-5) is a chemical compound with the molecular formula C7H9FO2S2 and a molecular weight of 208.3 g/mol. IUPAC name: 2,4,5-trimethylthiophene-3-sulfonyl fluoride. InChIKey: CTKUKAAABVSECY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9FO2S2
Molecular weight208.3 g/mol
IUPAC name2,4,5-trimethylthiophene-3-sulfonyl fluoride
InChIKeyCTKUKAAABVSECY-UHFFFAOYSA-N
SMILESCC1=C(SC(=C1S(=O)(=O)F)C)C

Computed by PubChem (NCBI)