CAS 2138351-52-5 is the registry number for Trimethylthiophene-3-sulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,4,5-trimethylthiophene-3-sulfonyl fluoride (CAS 2138351-52-5) is a chemical compound with the molecular formula C7H9FO2S2 and a molecular weight of 208.3 g/mol. IUPAC name: 2,4,5-trimethylthiophene-3-sulfonyl fluoride. InChIKey: CTKUKAAABVSECY-UHFFFAOYSA-N.
| Molecular formula | C7H9FO2S2 |
|---|---|
| Molecular weight | 208.3 g/mol |
| IUPAC name | 2,4,5-trimethylthiophene-3-sulfonyl fluoride |
| InChIKey | CTKUKAAABVSECY-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1S(=O)(=O)F)C)C |
Computed by PubChem (NCBI)