Products 2138422-71-4

CAS 2138422-71-4 is the registry number for rac-tert-Butyl N-((1R,3S)-3-(sulfamoylmethyl)cyclopentyl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(1R,3S)-3-(sulfamoylmethyl)cyclopentyl]carbamate (CAS 2138422-71-4) is a chemical compound with the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. IUPAC name: tert-butyl N-[(1R,3S)-3-(sulfamoylmethyl)cyclopentyl]carbamate. InChIKey: SYJLDJITFWJHRN-DTWKUNHWSA-N.

Identity
Molecular formulaC11H22N2O4S
Molecular weight278.37 g/mol
IUPAC nametert-butyl N-[(1R,3S)-3-(sulfamoylmethyl)cyclopentyl]carbamate
InChIKeySYJLDJITFWJHRN-DTWKUNHWSA-N
SMILESCC(C)(C)OC(=O)N[C@@H]1CC[C@@H](C1)CS(=O)(=O)N

Computed by PubChem (NCBI)