CAS 2138422-71-4 is the registry number for rac-tert-Butyl N-((1R,3S)-3-(sulfamoylmethyl)cyclopentyl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl N-[(1R,3S)-3-(sulfamoylmethyl)cyclopentyl]carbamate (CAS 2138422-71-4) is a chemical compound with the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. IUPAC name: tert-butyl N-[(1R,3S)-3-(sulfamoylmethyl)cyclopentyl]carbamate. InChIKey: SYJLDJITFWJHRN-DTWKUNHWSA-N.
| Molecular formula | C11H22N2O4S |
|---|---|
| Molecular weight | 278.37 g/mol |
| IUPAC name | tert-butyl N-[(1R,3S)-3-(sulfamoylmethyl)cyclopentyl]carbamate |
| InChIKey | SYJLDJITFWJHRN-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](C1)CS(=O)(=O)N |
Computed by PubChem (NCBI)