Products 2138424-47-0

CAS 2138424-47-0 is the registry number for 4-​(2-​Bromoethoxy)​tetrahydro-2H-​thiopyran 1,​1-​dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-(2-bromoethoxy)thiane 1,1-dioxide (CAS 2138424-47-0) is a chemical compound with the molecular formula C7H13BrO3S and a molecular weight of 257.15 g/mol. IUPAC name: 4-(2-bromoethoxy)thiane 1,1-dioxide. InChIKey: RIAFBPDEAJBXJI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13BrO3S
Molecular weight257.15 g/mol
IUPAC name4-(2-bromoethoxy)thiane 1,1-dioxide
InChIKeyRIAFBPDEAJBXJI-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CCC1OCCBr

Computed by PubChem (NCBI)