CAS 2138484-13-4 appears in our catalog under these names: Boc–NH–PEG4–C2–Boc, 1,17-Bis(1,1-dimethylethyl) 5,8,11,14-tetraoxa-2-azaheptadecanedioate, 98%, 98%, Boc-NH-PEG4-C2-Boc, 98.74%, Boc-NH-PEG4-C2-Boc, 98%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 100 mg, 25 mg, 250 mg, 50 mg.
Tert-butyl 3-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 2138484-13-4) is a chemical compound with the molecular formula C20H39NO8 and a molecular weight of 421.5 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: HOBFRUPMGLPRSJ-UHFFFAOYSA-N.
| Molecular formula | C20H39NO8 |
|---|---|
| Molecular weight | 421.5 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | HOBFRUPMGLPRSJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)