CAS 2138517-32-3 is the registry number for Sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate (CAS 2138517-32-3) is a chemical compound with the molecular formula C5H3BrNNaO2S and a molecular weight of 244.04 g/mol. IUPAC name: sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate. InChIKey: QUSVPKAEQIOZIE-UHFFFAOYSA-M.
| Molecular formula | C5H3BrNNaO2S |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate |
| InChIKey | QUSVPKAEQIOZIE-UHFFFAOYSA-M |
| SMILES | CC1=C(SC(=N1)C(=O)[O-])Br.[Na+] |
Computed by PubChem (NCBI)