Products 2138522-74-2
CAS 2138522-74-2 is the registry number for rac-(4R,6S)-4,6-Dimethyl-4H,6H,7H-pyrano(4,3-d)(1,3)thiazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4S,6R)-4,6-dimethyl-6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-amine (CAS 2138522-74-2) is a chemical compound with the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. IUPAC name: (4S,6R)-4,6-dimethyl-6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-amine. InChIKey: UFYIWZHJBCLUKF-UHNVWZDZSA-N.
| Molecular formula | C8H12N2OS |
|---|---|
| Molecular weight | 184.26 g/mol |
| IUPAC name | (4S,6R)-4,6-dimethyl-6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-amine |
| InChIKey | UFYIWZHJBCLUKF-UHNVWZDZSA-N |
| SMILES | C[C@@H]1CC2=C([C@@H](O1)C)SC(=N2)N |
Computed by PubChem (NCBI)