Products 2138565-42-9
CAS 2138565-42-9 is the registry number for rac-(1R,7R,8S)-2-Azabicyclo(5.1.0)octan-8-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1R,7R,8S)-2-azabicyclo[5.1.0]octan-8-amine (CAS 2138565-42-9) is a chemical compound with the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. IUPAC name: (1R,7R,8S)-2-azabicyclo[5.1.0]octan-8-amine. InChIKey: AHQJMIFBSXTFKT-DSYKOEDSSA-N.
| Molecular formula | C7H14N2 |
|---|---|
| Molecular weight | 126.20 g/mol |
| IUPAC name | (1R,7R,8S)-2-azabicyclo[5.1.0]octan-8-amine |
| InChIKey | AHQJMIFBSXTFKT-DSYKOEDSSA-N |
| SMILES | C1CCN[C@@H]2[C@H](C1)[C@@H]2N |
Computed by PubChem (NCBI)