CAS 2138566-81-9 is the registry number for Ethyl 5-bromo-4-(chlorosulfonyl)-2-methylbenzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 5-bromo-4-chlorosulfonyl-2-methylbenzoate (CAS 2138566-81-9) is a chemical compound with the molecular formula C10H10BrClO4S and a molecular weight of 341.61 g/mol. IUPAC name: ethyl 5-bromo-4-chlorosulfonyl-2-methylbenzoate. InChIKey: BIKFKEAAWKPYAH-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClO4S |
|---|---|
| Molecular weight | 341.61 g/mol |
| IUPAC name | ethyl 5-bromo-4-chlorosulfonyl-2-methylbenzoate |
| InChIKey | BIKFKEAAWKPYAH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1C)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)