Products 21386-86-7
CAS 21386-86-7 is the registry number for 3,3-Dimethylacrylic acid-d6. Offered by: MedChemExpress. Available pack sizes: 1 mg.
4,4,4-trideuterio-3-(trideuteriomethyl)but-2-enoic acid (CAS 21386-86-7) is a chemical compound with the molecular formula C5H8O2 and a molecular weight of 106.15 g/mol. IUPAC name: 4,4,4-trideuterio-3-(trideuteriomethyl)but-2-enoic acid. InChIKey: YYPNJNDODFVZLE-WFGJKAKNSA-N.
| Molecular formula | C5H8O2 |
|---|---|
| Molecular weight | 106.15 g/mol |
| IUPAC name | 4,4,4-trideuterio-3-(trideuteriomethyl)but-2-enoic acid |
| InChIKey | YYPNJNDODFVZLE-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(=CC(=O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
3-Methylcrotonic acid-d6