Products 2138924-36-2
CAS 2138924-36-2 appears in our catalog under these names: WRR139, WRR139, 99.71%, WRR139, 99%, WRR139 >= 98 % HPLC. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat, Sigma-Aldrich. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100mg, 5 mg, 50 mg, 10 mg.
(2S)-N-(3-methylbutyl)-2-[[(E)-3-(4-methylphenyl)sulfonylprop-2-enoyl]amino]-4-phenylbutanamide (CAS 2138924-36-2) is a chemical compound with the molecular formula C25H32N2O4S and a molecular weight of 456.6 g/mol. IUPAC name: (2S)-N-(3-methylbutyl)-2-[[(E)-3-(4-methylphenyl)sulfonylprop-2-enoyl]amino]-4-phenylbutanamide. InChIKey: BLEQGDOEDLJWCG-NGIFANIDSA-N.
| Molecular formula | C25H32N2O4S |
|---|---|
| Molecular weight | 456.6 g/mol |
| IUPAC name | (2S)-N-(3-methylbutyl)-2-[[(E)-3-(4-methylphenyl)sulfonylprop-2-enoyl]amino]-4-phenylbutanamide |
| InChIKey | BLEQGDOEDLJWCG-NGIFANIDSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)/C=C/C(=O)N[C@@H](CCC2=CC=CC=C2)C(=O)NCCC(C)C |
Computed by PubChem (NCBI)