CAS 21391-99-1 appears in our catalog under these names: alfa-Calacorene, α-Calacorene. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 20 μL.
(1S)-4,7-dimethyl-1-propan-2-yl-1,2-dihydronaphthalene (CAS 21391-99-1) is a chemical compound with the molecular formula C15H20 and a molecular weight of 200.32 g/mol. IUPAC name: (1S)-4,7-dimethyl-1-propan-2-yl-1,2-dihydronaphthalene. InChIKey: CUUMXRBKJIDIAY-ZDUSSCGKSA-N.
| Molecular formula | C15H20 |
|---|---|
| Molecular weight | 200.32 g/mol |
| IUPAC name | (1S)-4,7-dimethyl-1-propan-2-yl-1,2-dihydronaphthalene |
| InChIKey | CUUMXRBKJIDIAY-ZDUSSCGKSA-N |
| SMILES | CC1=CC[C@H](C2=C1C=CC(=C2)C)C(C)C |
Computed by PubChem (NCBI)