CAS 2139228-53-6 is the registry number for Rel-ethyl (1R,3s,5S,6r)-3-((tert-butyldimethylsilyl)oxy)bicyclo[3.1.0]hexane-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (1R,5S)-3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.1.0]hexane-6-carboxylate (CAS 2139228-53-6) is a chemical compound with the molecular formula C15H28O3Si and a molecular weight of 284.47 g/mol. IUPAC name: ethyl (1R,5S)-3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.1.0]hexane-6-carboxylate. InChIKey: WSTFGTBEGTVECT-UNTZMWQOSA-N.
| Molecular formula | C15H28O3Si |
|---|---|
| Molecular weight | 284.47 g/mol |
| IUPAC name | ethyl (1R,5S)-3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.1.0]hexane-6-carboxylate |
| InChIKey | WSTFGTBEGTVECT-UNTZMWQOSA-N |
| SMILES | CCOC(=O)C1[C@H]2[C@@H]1CC(C2)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)