Products 21394-50-3

CAS 21394-50-3 is the registry number for 4-(Methylthio)-2-octanamidobutanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-methylsulfanyl-2-(octanoylamino)butanoic acid (CAS 21394-50-3) is a chemical compound with the molecular formula C13H25NO3S and a molecular weight of 275.41 g/mol. IUPAC name: 4-methylsulfanyl-2-(octanoylamino)butanoic acid. InChIKey: QZNATRWVQKQCCC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H25NO3S
Molecular weight275.41 g/mol
IUPAC name4-methylsulfanyl-2-(octanoylamino)butanoic acid
InChIKeyQZNATRWVQKQCCC-UHFFFAOYSA-N
SMILESCCCCCCCC(=O)NC(CCSC)C(=O)O

Computed by PubChem (NCBI)