Products 213967-57-8

CAS 213967-57-8 is the registry number for Tiotropium bromide Impurity 29 (Dioxane tetraketone). Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1,4-dioxane-2,3,5,6-tetrone (CAS 213967-57-8) is a chemical compound with the molecular formula C4O6 and a molecular weight of 144.04 g/mol. IUPAC name: 1,4-dioxane-2,3,5,6-tetrone. InChIKey: WBHICAWASPYOHL-UHFFFAOYSA-N.

Identity
Molecular formulaC4O6
Molecular weight144.04 g/mol
IUPAC name1,4-dioxane-2,3,5,6-tetrone
InChIKeyWBHICAWASPYOHL-UHFFFAOYSA-N
SMILESC1(=O)C(=O)OC(=O)C(=O)O1

Computed by PubChem (NCBI)