CAS 2140305-76-4 is the registry number for 1-Chloro-2,4-difluoro-5-(methoxy-d3)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-chloro-2,4-difluoro-5-(trideuteriomethoxy)benzene (CAS 2140305-76-4) is a chemical compound with the molecular formula C7H5ClF2O and a molecular weight of 181.58 g/mol. IUPAC name: 1-chloro-2,4-difluoro-5-(trideuteriomethoxy)benzene. InChIKey: FZDCQMDEJJMLAZ-FIBGUPNXSA-N.
| Molecular formula | C7H5ClF2O |
|---|---|
| Molecular weight | 181.58 g/mol |
| IUPAC name | 1-chloro-2,4-difluoro-5-(trideuteriomethoxy)benzene |
| InChIKey | FZDCQMDEJJMLAZ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=C(C=C1F)F)Cl |
Computed by PubChem (NCBI)