CAS 2140326-46-9 is the registry number for Diethyl 2-(tert-butyldimethylsilyloxy)methyl-2-ethylmalonate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Diethyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethylpropanedioate (CAS 2140326-46-9) is a chemical compound with the molecular formula C16H32O5Si and a molecular weight of 332.51 g/mol. IUPAC name: diethyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethylpropanedioate. InChIKey: HOOACVDSEICKCV-UHFFFAOYSA-N.
| Molecular formula | C16H32O5Si |
|---|---|
| Molecular weight | 332.51 g/mol |
| IUPAC name | diethyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethylpropanedioate |
| InChIKey | HOOACVDSEICKCV-UHFFFAOYSA-N |
| SMILES | CCC(CO[Si](C)(C)C(C)(C)C)(C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)