CAS 2140326-47-0 is the registry number for 3-Bromo-5-fluoro-2-methoxy-4-nitroaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-bromo-5-fluoro-2-methoxy-4-nitroaniline (CAS 2140326-47-0) is a chemical compound with the molecular formula C7H6BrFN2O3 and a molecular weight of 265.04 g/mol. IUPAC name: 3-bromo-5-fluoro-2-methoxy-4-nitroaniline. InChIKey: NLNFZUVHYNGFMB-UHFFFAOYSA-N.
| Molecular formula | C7H6BrFN2O3 |
|---|---|
| Molecular weight | 265.04 g/mol |
| IUPAC name | 3-bromo-5-fluoro-2-methoxy-4-nitroaniline |
| InChIKey | NLNFZUVHYNGFMB-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1N)F)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)