CAS 2140327-32-6 is the registry number for Fenamiphos D3 (S-methyl D3). Offered by: Dr. Ehrenstorfer. Available pack sizes: 10mg.
N-[ethoxy-[3-methyl-4-(trideuteriomethylsulfanyl)phenoxy]phosphoryl]propan-2-amine (CAS 2140327-32-6) is a chemical compound with the molecular formula C13H22NO3PS and a molecular weight of 306.38 g/mol. IUPAC name: N-[ethoxy-[3-methyl-4-(trideuteriomethylsulfanyl)phenoxy]phosphoryl]propan-2-amine. InChIKey: ZCJPOPBZHLUFHF-VPYROQPTSA-N.
| Molecular formula | C13H22NO3PS |
|---|---|
| Molecular weight | 306.38 g/mol |
| IUPAC name | N-[ethoxy-[3-methyl-4-(trideuteriomethylsulfanyl)phenoxy]phosphoryl]propan-2-amine |
| InChIKey | ZCJPOPBZHLUFHF-VPYROQPTSA-N |
| SMILES | [2H]C([2H])([2H])SC1=C(C=C(C=C1)OP(=O)(NC(C)C)OCC)C |
Computed by PubChem (NCBI)